JEE Main 2026 · previous year paper

JEE Main 2026 — 6 April, Evening Shift

64 questions with the verified answer key. Open any question for its step-by-step solution.

  1. Question 1Physics· Units, Dimensions & Error Analysis

    The percentage error in the calculated volume of a sphere, if there is 2%2\% error in its diameter measurement, is

    1. Option A:

      1

    2. Option B:

      2

    3. Option C:

      6

    4. Option D:

      8

  2. Question 2Physics· Rotational Dynamics

    A solid sphere (A) of mass 5m and spherical shell (B) of mass m, both having same radius, are placed on a rough surface. When a force of same magnitude is applied tangentially at the highest points of A and B, they start rolling without slipping with an acceleration of aAa_A and aBa_B respectively. The ratio of aAa_A and aBa_B is

    1. Option A:

      5:21

    2. Option B:

      6:10

    3. Option C:

      21:25

    4. Option D:

      1:5

  3. Question 3Physics· Work, Power & Energy

    A body of mass 1kg1\mathrm{kg} moves along a straight line with a velocity v=2x2v = 2x^2. The work done by the body during displacement from x=0x = 0 to 5m5\mathrm{m} is J.

    1. Option A:

      0

    2. Option B:

      250

    3. Option C:

      1250

    4. Option D:

      1000

  4. Question 4Physics· Thermodynamics

    A cylinder with adiabatic walls is closed at both ends and is divided into two compartments by a frictionless adiabatic piston. Ideal gas is filled in both compartments at same P, V, T. Heating is started from left side until pressure changes to 27P8\frac{27P}{8}. If initial volume of each compartment was 9 litres then the final volume in right-hand side compartment is ______ litres. (for this ideal gas Cp/Cv=1.5C_p/C_v = 1.5)

    1. Option A:

      3

    2. Option B:

      4

    3. Option C:

      14

    4. Option D:

      9

  5. Question 5Physics· Electromagnetic Waves

    For an electromagnetic wave propagating through vacuum, k⃗\vec{k}, E⃗\vec{E} and ω\omega represent propagation vector, electric field and angular frequency, respectively. The magnetic field associated with this wave is represented by:

    1. Option A:

      E⃗×k⃗ω\frac{\vec{E}\times\vec{k}}{\omega}

    2. Option B:

      k⃗×E⃗ω\frac{\vec{k}\times\vec{E}}{\omega}

    3. Option C:

      ω(E⃗×k⃗)\omega(\vec{E}\times\vec{k})

    4. Option D:

      ω(k⃗×E⃗)\omega(\vec{k}\times\vec{E})

  6. Question 6Physics· System Of Particles

    Two identical bodies A and B of equal masses have initial velocities v⃗1=4i^m/s\vec{v}_1 = 4\hat{i}\mathrm{m/s} and v⃗2=4j^m/s\vec{v}_2 = 4\hat{j}\mathrm{m/s} respectively. The body A has acceleration a⃗1=6i^+6j^m/s2\vec{a}_1 = 6\hat{i}+6\hat{j}\mathrm{m/s}^2 while the acceleration of the other body B is zero. The centre of mass of the two bodies moves in ______ path.

    1. Option A:

      circular

    2. Option B:

      parabolic

    3. Option C:

      straight line

    4. Option D:

      elliptical

  7. Question 7Physics· Fluid Mechanics

    A cylindrical vessel of 40cm40\mathrm{cm} radius is completely filled with water and its capacity is 528dm3528\mathrm{dm}^3 (dm: decimeter). The vessel is placed on a solid block of exactly same height as vessel. If a small hole is made at 70cm70\mathrm{cm} below the top of water level, then horizontal range of water falling on the ground in the beginning is ______ cm.

    1. Option A:

      1202120\sqrt{2}

    2. Option B:

      1402140\sqrt{2}

    3. Option C:

      1403140\sqrt{3}

    4. Option D:

      1203120\sqrt{3}

  8. Question 8Physics· Kinetic Theory of Gases

    If 2 mole of an ideal monoatomic gas at temperature T, is mixed with 6 mole of another ideal monoatomic gas at temperature 2T then the temperature of mixture is:

    1. Option A:

      52T\frac{5}{2}T

    2. Option B:

      54T\frac{5}{4}T

    3. Option C:

      72T\frac{7}{2}T

    4. Option D:

      74T\frac{7}{4}T

  9. Question 9Physics· Simple Harmonic Motion

    A spring stretches by 2mm2\mathrm{mm} when it is loaded with a mass of 200g200\mathrm{g}. From equilibrium position the mass is further pulled down by 2mm2\mathrm{mm} and released. The frequency associated with the system and maximum energy in the spring are ______ Hz and ______ J, respectively. (Take g=10m/s2g = 10\mathrm{m/s}^2)

    1. Option A:

      550π\frac{5\sqrt{50}}{\pi} and 8×10−38\times10^{-3}

    2. Option B:

      550π\frac{5\sqrt{50}}{\pi} and 8

    3. Option C:

      105010\sqrt{50} and 2×10−32\times10^{-3}

    4. Option D:

      550π\frac{5\sqrt{50}}{\pi} and 16×10−316\times10^{-3}

  10. Question 10Physics· Electrostatics

    The electric potential as a function of x, y is given by V=5(x2−y2)V = 5(x^2 - y^2) V. The electric field at a point (2, 3) m is ______ V/m.

    1. Option A:

      (−20i^+30j^)(-20\hat{i} + 30\hat{j})

    2. Option B:

      (20i^−30j^)(20\hat{i} - 30\hat{j})

    3. Option C:

      (20i^+45j^)(20\hat{i} + 45\hat{j})

    4. Option D:

      (−4i^+6j^)(-4\hat{i} + 6\hat{j})

  11. Question 11Physics· Electromagnetic Induction

    A square loop of side 2 cm is placed in a time varying magnetic field with magnitude as B=0.4sin⁡(300t)B = 0.4 \sin(300t) Tesla. The normal to the plane of loop makes an angle of 60° with the field. The maximum induced emf produced in the loop is ______ mV.

    1. Option A:

      12

    2. Option B:

      18

    3. Option C:

      21

    4. Option D:

      24

  12. Question 12Physics· Capacitors and R-C Circuits

    A sphere of capacitance 100 pF is charged to a potential of 100 V. Another identical undercharged metal sphere is brought in contact with the charged sphere, then the change in the total energy stored on these spheres, when they touch is α×10−7\alpha \times 10^{-7} J. The value of α\alpha is ______. (combined capacitance of spheres is 200 pF).

    1. Option A:

      5

    2. Option B:

      2.5

    3. Option C:

      46060

    4. Option D:

      3

  13. Question 13Physics· Nuclear Physics

    The energy released if hydrogen atoms are combined to form 24He^4_2\mathrm{He} is ______ MeV. (Take binding energies per nucleon of hydrogen as 1.1 MeV and of helium as 7.2 MeV).

    1. Option A:

      6.1

    2. Option B:

      24.4

    3. Option C:

      26.6

    4. Option D:

      5

  14. Question 14Physics· Geometrical Optics

    Angle of minimum deviation is equal to the half of the angle of prism in an equilateral prism. The refractive index of the prism is

    1. Option A:

      1.5

    2. Option B:

      3\sqrt{3}

    3. Option C:

      2\sqrt{2}

    4. Option D:

      1.65

  15. Question 15Physics· Wave Optics

    In a Young double slit experiment, the wavelength of incident light is 6000A˚6000\mathrm{\AA}, the separation between slits is 5cm5\mathrm{cm}, the distance between slits plane and screen is 50cm50\mathrm{cm} as shown in the figure. If the resultant intensity at P is equal to the intensity due to individual slits, the path difference between interfering waves is ______ Å.

    Question 15 figure
    1. Option A:

      4000

    2. Option B:

      3000

    3. Option C:

      2000

    4. Option D:

      1000

  16. Question 16Physics· Friction

    A block takes t time to slide down a plane inclined at 45∘45^\circ to the horizontal. If the surface is made smooth (frictionless), the block takes time t/2t/2 to slide down the plane. The coefficient of friction between the block and the inclined plane is (α100)\left(\frac{\alpha}{100}\right). The value of α\alpha is ______.

    Question 16 figure
  17. Question 17Physics· Atomic Physics

    The de Broglie wavelength for an electron accelerated through the potential difference V1V_1 volt is λ1\lambda_1. When the potential difference is changed to V2V_2 volt, the associated de Broglie wavelength is increased by 50%50\%. If (V1/V2)=(9/α)(V_1/V_2) = (9/\alpha), then the value of α\alpha is ______.

  18. Question 18Physics· Current Electricity

    A moving coil of a galvanometer when shunted with 2Ω2\Omega resistance gives a full scale deflection for a current of 500mA500\mathrm{mA}. When a resistance of 470Ω470\Omega is connected in series it gives a full scale deflection for 10V10\mathrm{V} potential applied on it. The value of resistance of galvanometer coil is Ω\Omega.

  19. Question 19Physics· Current Electricity

    Two cells of emfs 1V and 2V and internal resistance 2Ω and 1Ω, respectively connected in parallel, gave current of 1A through an external resistance. If the polarity of one cell is reversed, then value of current through the external resistance will be α5\frac{\alpha}{5} A. The value of α\alpha is ______.

  20. Question 20Physics· Geometrical Optics

    A concave mirror of focal length 10cm10\mathrm{cm} forms an image which is double the size of object when the object is placed at two different positions. The distance between the two positions of the object is ______ cm.

  21. Question 21Mathematics· Functions

    Let f:R→Rf: \mathbb{R} \to \mathbb{R} be defined as f(x)=2x2−3x+23x2+x+3f(x) = \frac{2x^2 - 3x + 2}{3x^2 + x + 3}. Then ff is:

    1. Option A:

      both one-one and onto

    2. Option B:

      one-one but not onto

    3. Option C:

      onto but not one-one

    4. Option D:

      neither one-one nor onto

  22. Question 22Mathematics· Quadratic Equations

    Consider the quadratic equation (n2−2n+2)x2−3x+(n2−2n+2)2=0(n^2 - 2n + 2)x^2 - 3x + (n^2 - 2n + 2)^2 = 0 , n∈Rn \in \mathbb{R} . Let α\alpha be the minimum value of the product of its roots and β\beta be the maximum value of the sum of its roots. Then the sum of the first six terms of the G.P., whose first term is α\alpha and the common ratio is αβ\frac{\alpha}{\beta} , is:

    1. Option A:

      6137\frac{61}{37}

    2. Option B:

      12181\frac{121}{81}

    3. Option C:

      364243\frac{364}{243}

    4. Option D:

      1093729\frac{1093}{729}

  23. Question 23Mathematics· Complex Numbers

    Let S={z∈C:z2+6iz−3=0}S = \left\{z \in \mathbb{C}: z^2 + \sqrt{6} iz - 3 = 0\right\} . Then ∑z∈Sz8\sum_{z \in S} z^8 is equal to:

    1. Option A:

      162162

    2. Option B:

      184184

    3. Option C:

      262262

    4. Option D:

      324324

  24. Question 24Mathematics· Determinants

    The sum of all possible values of θ∈[0,2π]\theta \in [0, 2\pi ], for which the system of equations: xcos3θ−8y−12z=0,xcos2θ+3y+3z=0,x+y+3z=0x cos3θ - 8y - 12z = 0, x cos2θ + 3y + 3z = 0, x + y + 3z = 0 has a non-trivial solution, is equal to:

    1. Option A:

      π

    2. Option B:

      2π

    3. Option C:

      3π

    4. Option D:

      4π

  25. Question 25Mathematics· Matrices

    Let A=[[1,0,0],[3,1,0],[9,3,1]]A = [[1,0,0],[3,1,0],[9,3,1]] and B=[bij],1≤i,j≤3.B = [b_ij], 1≤i,j≤3. If B=A99−I,B = A^99 - I, then the value of (b31−b21)b32\frac{(b_{31} - b_{21})}{b_{32}} is:

    1. Option A:

      99

    2. Option B:

      199

    3. Option C:

      149

    4. Option D:

      159

  26. Question 26Mathematics· Sequence and Series

    The value of ∑n=12008n4+2n3+3n2+2n+1n(n+1)\sum_{n=1}^{2008} \frac{\sqrt{n^{4}+2 n^{3}+3 n^{2}+2 n+1}}{n(n+1)} is equal to

    1. Option A:

      2008+200820092008+\frac{2008}{2009}

    2. Option B:

      2007+200820092007+\frac{2008}{2009}

    3. Option C:

      2008+200720092008+\frac{2007}{2009}

    4. Option D:

      2008+200720082008+\frac{2007}{2008}

  27. Question 27Mathematics· Permutations and Combinations

    A building has ground floor and 1010 more floors. Nine persons enter in a lift at the ground floor. The lift goes up to the 1010th floor. The number of ways, in which any 44 persons exit at a floor and the remaining 55 persons exit at a different floor, if the lift does not stop at the first and the second floors, is equal to :

    1. Option A:

      21842184

    2. Option B:

      30643064

    3. Option C:

      70567056

    4. Option D:

      1134011340

  28. Question 28Mathematics· Probability

    A bag contains 6 blue and 6 green balls. Pairs of balls are drawn without replacement until the bag is empty. The probability that each drawn pair consists of one blue and one green ball is :

    1. Option A:

      63925\frac{63}{925}

    2. Option B:

      17231\frac{17}{231}

    3. Option C:

      16231\frac{16}{231}

    4. Option D:

      64925\frac{64}{925}

  29. Question 29Mathematics· Circles

    Let C be a circle having centre in the first quadrant and touching the x-axis at a distance 33 units from the origin. If the circle C has an intercept of length 636\sqrt3 on y-axis, then the length of the chord of the circle C on the line x−y=3x-y=3 is:

    1. Option A:

      88

    2. Option B:

      66

    3. Option C:

      626\sqrt2

    4. Option D:

      828\sqrt2

  30. Question 30Mathematics· Hyperbola

    The eccentricity of an ellipse EE with centre at the origin O is 32\frac{\sqrt3}{2} and its directrices are x=±46/3x = ±4\sqrt6/3. Let H:x2a2−y2b2=1H: \frac{x²}{a²} - \frac{y²}{b²} = 1 be a hyperbola whose eccentricity is equal to the length of semi-major axis of E, and whose length of latus rectum is equal to the length of minor axis of E.E. Then the distance between the foci of HH is :

    1. Option A:

      427\frac{4 \sqrt{2}}{\sqrt{7}}

    2. Option B:

      427\frac{4 \sqrt{2}}{7}

    3. Option C:

      47\frac{4}{\sqrt{7}}

    4. Option D:

      87\frac{8}{7}

  31. Question 31Mathematics· Ellipse

    Let x=9\mathrm{x}=9 be a directrix of an ellipse E , whose centre is at the origin and eccentricity is 13\frac{1}{3}. Let P(α,0),α>0\mathrm{P}(\alpha, 0), \alpha>0, be a focus of E and AB be a chord passing through P . Then the locus of the mid point of AB is :

    1. Option A:

      9y²=8x(1-x)

    2. Option B:

      3y²=4x(1-x)

    3. Option C:

      9y²=8x(x-1)

    4. Option D:

      3y²=4x(x-1)

  32. Question 32Mathematics· Inverse Trigonometric Functions

    If sin⁡(tan⁡−1(x2))=cot⁡(sin⁡−11−x2)\sin \left(\tan^{-1}(x\sqrt{2})\right) = \cot \left(\sin^{-1}\sqrt{1-x^2}\right), x∈(0,1)x\in (0,1), then the value of x is :

    1. Option A:

      12\frac{1}{2}

    2. Option B:

      13\frac{1}{3}

    3. Option C:

      23\frac{2}{3}

    4. Option D:

      58\frac{5}{8}

  33. Question 33Mathematics· 3D Geometry

    The shortest distance between the lines x−41=y−32=z−2−3\frac{x-4}{1} = \frac{y-3}{2} = \frac{z-2}{-3} and x+22=y−64=z−5−5\frac{x+2}{2} = \frac{y-6}{4} = \frac{z-5}{-5} is:

    1. Option A:

      566\frac{5 \sqrt{6}}{6}

    2. Option B:

      252 \sqrt{5}

    3. Option C:

      353 \sqrt{5}

    4. Option D:

      454 \sqrt{5}

  34. Question 34Mathematics· Vector Algebra

    Let a⃗=2i^+3j^+3k^\vec{a} = 2\hat{i} +3\hat{j} +3\hat{k} and b⃗=6i^+3j^+3k^\vec{b} = 6\hat{i} +3\hat{j} +3\hat{k}. Then the square of the area of the triangle with adjacent sides determined by the vectors (2a⃗+3b⃗)(2\vec{a}+3\vec{b}) and (a⃗−b⃗)(\vec{a}-\vec{b}) is :

    1. Option A:

      450450

    2. Option B:

      900900

    3. Option C:

      18001800

    4. Option D:

      24002400

  35. Question 35Mathematics· Limits, Continuity and Differentiability

    Let lim⁡x→2(tan⁡(x−2))(rx2+(p−2)x−2p)(x−2)2=5\lim_{x\to 2}\frac{(\tan(x-2))(rx^{2} + (p-2)x - 2p)}{(x-2)^{2}} = 5 for some r,p∈R.r,p∈R. If the set of all possible values of qq such that the roots of the equation rx2−px+q=0rx^{2} - px + q = 0 lie in (0,2),(0,2), be the interval (α,β],(α,β], then 4(α+β)4(α+β) equals:

    1. Option A:

      11

    2. Option B:

      13

    3. Option C:

      17

    4. Option D:

      21

  36. Question 36Mathematics· Application of Derivatives

    Let A=∣13−121α01−1∣A = \begin{vmatrix}1 & 3 & -1\\ 2 & 1 & \alpha \\ 0 & 1 & -1\end{vmatrix} be a singular matrix. Let f(x)=∫0x(t2+2t+3)dtf(x) = \int_{0}^{x}(t^{2} + 2t + 3)dt, x∈[1,α].x∈[1,α]. If M and m are respectively the maximum and the minimum values of f in [1,α][1,α] then 3(M−m)3(M-m) is equal to:

    1. Option A:

      6464

    2. Option B:

      6868

    3. Option C:

      7272

    4. Option D:

      7676

  37. Question 37Mathematics· Functions

    Let f:R→Rf:R→R be such that f(xy)=f(x)f(y)f(xy)=f(x)f(y) for all x,y∈Rx,y∈R and f(0)≠0.Letg:[1,∞)→Rf(0)≠0. Let g:[1,∞)→R be a differentiable function such that x2g(x)=∫1x(t2f(t)−tg(t))dtx^{2}g(x) = \int_{1}^{x}(t^{2}f(t) - tg(t))dt. Then g(2)g(2) is equal to :

    1. Option A:

      138\frac{13}{8}

    2. Option B:

      1116\frac{11}{16}

    3. Option C:

      1532\frac{15}{32}

    4. Option D:

      1764\frac{17}{64}

  38. Question 38Mathematics· Area under the Curves

    The area of the region {(x,y):x2−8x≤y≤−x}\{(x,y): x^{2} - 8x \leq y \leq -x\} is:

    1. Option A:

      3436\frac{343}{6}

    2. Option B:

      6376\frac{637}{6}

    3. Option C:

      4376\frac{437}{6}

    4. Option D:

      5236\frac{523}{6}

  39. Question 39Mathematics· Definite Integration

    The value of the integral ∫−11x3+∣x∣+1x2+2∣x∣+1dx\int_{-1}^{1}\frac{x^{3}+|x|+1}{x^{2}+2|x|+1}dx is equal to :

    1. Option A:

      3log⁡e23 \log _{e} 2

    2. Option B:

      2log⁡e22 \log _{e} 2

    3. Option C:

      5log⁡e35 \log _{e} 3

    4. Option D:

      3log⁡e33 \log _{e} 3

  40. Question 40Mathematics· Sets and Relations

    Let R=(x,y)∈N×N:loge(x+y)≤2.R = {(x,y) ∈ N×N : log_e(x+y) ≤ 2}. Then the minimum number of elements required to be added in RR to make it a transitive relation, is _____.

  41. Question 41Mathematics· Binomial Theorem

    If (1−x3)10=∑r=010arx30−2r(1−x)r(1-x^3)^{10} = \sum_{r=0}^{10} a_r x^{30-2r}(1-x)^r, then 9a9a10\frac{9a_9}{a_{10}} is equal to ______.

  42. Question 42Mathematics· Circles

    Let the line x−y=4x-y=4 intersect the circle C:(x−4)2+(y+3)2=9C: (x-4)²+(y+3)²=9 at the points QQ and R.R. If P(α,β)P(α,β) is a point on CC such that PQ=PR,PQ=PR, then (6α+8β)2(6α+8β)² is equal to ______.

  43. Question 43Mathematics· 3D Geometry

    Let the image of the point P(0,-5,0) in the line x−12=y1=z+1−2\frac{x-1}{2} = \frac{y}{1} = \frac{z+1}{-2} be the point R and the image of the point Q(0,-1/2,0) in the line x−1−1=y+94=z+11\frac{x-1}{-1} = \frac{y+9}{4} = \frac{z+1}{1} be the point S. Then the square of the area of the parallelogram PQRS is ______.

  44. Question 44Mathematics· Limits, Continuity and Differentiability

    Let f(x)={x3+8,x<0x2−4,x≥0f(x) = \begin{cases} x^3+8, & x<0 \\ x^2-4, & x\ge 0 \end{cases} and g(x)={(x−8)1/3,x<0(x+4)1/2,x≥0g(x) = \begin{cases} (x-8)^{1/3}, & x<0 \\ (x+4)^{1/2}, & x\ge 0 \end{cases}. Then the number of points where the function g(f(x))g(f(x)) is discontinuous, is ______.

  45. Question 45Chemistry· Some Basic Concepts of Chemistry (Mole Concept) + Stoichiometry

    Which of the following contain the same number of atoms? (Given : Molar mass in gmol−1\mathrm{g} \mathrm{mol}^{-1} of H,He,O\mathrm{H}, \mathrm{He}, \mathrm{O} and S are 1,4,161,4,16 and 32 respectively) A. 2 g of O2\mathrm{O}_{2} gas B. 4 g fo SO2\mathrm{SO}_{2} gas C. 1400 mL of O2\mathrm{O}_{2} at STP D. 0.05 L of He at STP

    E, 0.0625 mol∘0.0625 \mathrm{~mol}^{\circ} of H2\mathrm{H}_{2} gas Choose the correct answer from the options given below :

    1. Option A:

      A and B only

    2. Option B:

      B and C only

    3. Option C:

      C and D only

    4. Option D:

      A, C and E only

  46. Question 46Chemistry· Structure of Atom

    The Bohr radius of a hydrogen like species is 70.53 pm . The species and the stationary state(n) are respectively (Given: Hydrogen atom Bohr radius is 52.9 pm )

    1. Option A:

      Li2+,3\mathrm{Li}^{2+}, 3

    2. Option B:

      He+,3\mathrm{He}^{+}, 3

    3. Option C:

      He+,2\mathrm{He}^{+}, 2

    4. Option D:

      Li2+,2\mathrm{Li}^{2+}, 2

  47. Question 47Chemistry· Chemical Bonding

    Given below are two statements:

    Statement I: The number of compounds among SO2,SO3,SF4,SF6\mathrm{SO}_{2}, \mathrm{SO}_{3}, \mathrm{SF}_{4}, \mathrm{SF}_{6} and H2 S\mathrm{H}_{2} \mathrm{~S} in which sulphur does not obey the Octet rule is 3 .

    Statement II : Among [H2O,ClF3,SF4],[NH3\left[\mathrm{H}_{2} \mathrm{O}, \mathrm{ClF}_{3}, \mathrm{SF}_{4}\right],\left[\mathrm{NH}_{3}\right., BrF5,SF4],[BrF5,ClF3,XeF4]\left.\mathrm{BrF}_{5}, \mathrm{SF}_{4}\right], \quad\left[\mathrm{BrF}_{5}, \quad \mathrm{ClF}_{3}, \quad \mathrm{XeF}_{4}\right] \quad and [XeF4\quad\left[\mathrm{XeF}_{4}\right., ClF3,H2O]\left.\mathrm{ClF}_{3}, \mathrm{H}_{2} \mathrm{O}\right], the number of sets in which all the molecules have one lone pair of electrons on the central atom is 1 .

    In the light of the above statements, choose the correct answer from the options given below :

    1. Option A:

      Both Statement I and Statement II are true

    2. Option B:

      Both Statement I and Statement II are false

    3. Option C:

      Statement I is true Statement II is false

    4. Option D:

      Statement I is false Statement II is true

  48. Question 48Chemistry· Thermodynamics & Thermochemistry

    Match List-I with List-II Given V1\mathrm{V}_{1} and V2\mathrm{V}_{2} are initial and final volumes respectively:

    List-I (Isothermal process)List-II (Expression)
    A. Reversible expansionI. q=0
    B. Free expansionII. q=nRTln⁡V2 V1\mathrm{q}=\mathrm{nRT} \ln \frac{\mathrm{V}_{2}}{\mathrm{~V}_{1}}
    C. Irreversible CompressionIII. w=−pext (V1−V2)\mathrm{w}=-\mathrm{p}_{\text {ext }}\left(\mathrm{V}_{1}-\mathrm{V}_{2}\right)
    D. Cyclic reversibleIV. qrev T=0\frac{\mathrm{q}_{\text {rev }}}{\mathrm{T}}=0

    Choose the correct answer from the options given below :

    1. Option A:

      A-II, B-III, C-I, D-IV

    2. Option B:

      A-II, B-I, C-IV, D-III

    3. Option C:

      A-II, B-I, C-III, D-IV

    4. Option D:

      A-I, B-II, C-III, D-IV

  49. Question 49Chemistry· Solutions and Colligative Properties

    Given below are two statements :

    Chamber 1Chamber 2
    18 g glucose in 100 mL aqueous solutionSemi permeable membrane30 g glucose in 250 mL aqueous solution

    Statement I: H2O\mathrm{H}_{2} \mathrm{O} molecules move from the chamber 1 to chamber 2.

    Statement II: The osmotic pressure of a solution prepared by dissolving 50 mg of potassium sulphate (molar mass =174 g/mol=174 \mathrm{~g} / \mathrm{mol} ) in 2 L of water (at 27∘C27^{\circ} \mathrm{C} ) is 0.0107 bar. (Given : R=0.083dm3\mathrm{R}=0.083 \mathrm{dm}^{3} bar K−1 mol−1\mathrm{K}^{-1} \mathrm{~mol}^{-1} and assume complete dissociation of electrolyte)

    In the light of the above statements, choose the correct answer from the options given below :

    1. Option A:

      Both Statement I and Statement II are true

    2. Option B:

      Both Statement I and Statement II are false

    3. Option C:

      Statement I is true but Statement II is false

    4. Option D:

      Statement I is false but Statement II is true

  50. Question 50Chemistry· Ionic Equilibrium

    Given is a concentrated solution of a weak electrolyte Ax By\mathrm{A}_{x} \mathrm{~B}_{y} of concentration ' c ' and dissociation constant ' K '. the degree of dissociation is given by:

    1. Option A:

      [K×cx+y−1xxyy]x+y\left[K \times c^{x+y-1} x^{x} y^{y}\right]^{x+y}

    2. Option B:

      (Kcx+y−1xxyy)1x+y\left(\frac{K}{c^{x+y-1} x^{x} y^{y}}\right)^{\frac{1}{x+y}}

    3. Option C:

      (cx+y−1xxyyK)x+y\left(\frac{c^{x+y-1} x^{x} y^{y}}{K}\right)^{x+y}

    4. Option D:

      (cx+y−1xxyyK)1x+y\left(\frac{c^{x+y-1} x^{x} y^{y}}{K}\right)^{\frac{1}{x+y}}

  51. Question 51Chemistry· Electrochemistry

    For a general redox reaction

    AnodeRedX1→OxX1Xn1++nX1eX−CathodeOxX2+nX2eX−→RedX2Xn2−\begin{array}{l l} \text{Anode} & \ce{Red1 -> Ox1^{n1+} + n1e^-} \\ \text{Cathode} & \ce{Ox2 + n2e^- -> Red2^{n2-}} \end{array}

    Which of the following statement is incorrect?

    1. Option A:

      The overall reaction can be written as n2Red⁡1+n1Ox2⇌n2Ox1n1++n1Red⁡2n2−\mathrm{n}_{2} \operatorname{Red}_{1}+\mathrm{n}_{1} \mathrm{Ox}_{2} \rightleftharpoons \mathrm{n}_{2} \mathrm{Ox}_{1}^{\mathrm{n}_{1}^{+}}+\mathrm{n}_{1} \operatorname{Red}_{2}{ }^{\mathrm{n}_{2}-}

    2. Option B:

      The electrons do not appear in the overall reaction because electrons produced at the anode are consumed at the cathode.

    3. Option C:

      Here nn is the number of electrons transferred in redox reaction.

    4. Option D:

      If the reaction is carried out reversibly, the electrical work done is equal to the ratio of charge and potential difference through which charge is moved.

  52. Question 52Chemistry· Periodicity of Elements and Periodic Properties

    In a period, the first ionisation enthalpy of the element at extreme left and the negative electron gain enthalpy of the extreme right element, except noble gases, are respectively.

    1. Option A:

      lowest and lowest

    2. Option B:

      highest and lowest

    3. Option C:

      lowest and highest

    4. Option D:

      highest and highest

  53. Question 53Chemistry· p-Block Elements (Group 15-18)

    Given below are two statements :

    Statement I: F2O<H2O<Cl2O\mathrm{F}_{2} \mathrm{O}<\mathrm{H}_{2} \mathrm{O}<\mathrm{Cl}_{2} \mathrm{O} is the correct trend in terms of bond angle.

    Statement II : SiF4,SnF4\mathrm{SiF}_{4}, \mathrm{SnF}_{4} and PbF4\mathrm{PbF}_{4} are ionic in nature.

    In the light of the above statements, choose the correct answer from the options given below:

    1. Option A:

      Both Statement I and Statement II are true

    2. Option B:

      Both Statement I and Statement II are false

    3. Option C:

      Statement I is true but Statement II is false

    4. Option D:

      Statement I is false but Statement II is true

  54. Question 54Chemistry· Periodicity of Elements and Periodic Properties

    The correct order of first (ΔiH1)\left(\Delta_{\mathrm{i}} \mathrm{H}_{1}\right) and second (ΔiH2)\left(\Delta_{\mathrm{i}} \mathrm{H}_{2}\right) ionisation enthalpy values of cr and Mn are : A. ΔiH1:Cr>Mn\Delta_{\mathrm{i}} \mathrm{H}_{1}: \mathrm{Cr}>\mathrm{Mn} B. ΔiH2:Cr>Mn\Delta_{\mathrm{i}} \mathrm{H}_{2}: \mathrm{Cr}>\mathrm{Mn} C. ΔiH1:Mn>Cr\Delta_{\mathrm{i}} \mathrm{H}_{1}: \mathrm{Mn}>\mathrm{Cr} D. ΔiH2:Mn>Cr\Delta_{\mathrm{i}} \mathrm{H}_{2}: \mathrm{Mn}>\mathrm{Cr}

    Choose the correct answer from the options given below :

    1. Option A:

      A and B only

    2. Option B:

      B and C only

    3. Option C:

      A and D only

    4. Option D:

      C and D only

  55. Question 55Chemistry· Coordination Compounds

    Which of the following sequence of hybridisation, geometry and magnetic nature are correct for the given coordination compounds ? A. [NiCl4]2−−sp3\left[\mathrm{NiCl}_{4}\right]^{2-}-\mathrm{sp}^{3}, tetrahedral, paramagnetic B. [Ni(NH3)6]2+−sp3 d2\left[\mathrm{Ni}\left(\mathrm{NH}_{3}\right)_{6}\right]^{2+}-\mathrm{sp}^{3} \mathrm{~d}^{2}, octahedral, paramagnetic C. [Ni(CO)4]−sp3\left[\mathrm{Ni}(\mathrm{CO})_{4}\right]-\mathrm{sp}^{3}, tetrahedral, paramagnetic D. [Ni(CN)4]2−−dsp2\left[\mathrm{Ni}(\mathrm{CN})_{4}\right]^{2-}-\mathrm{dsp}^{2}, square planar diamagnetic

    Choose the correct answer from the options given below :

    1. Option A:

      A, B, C and D

    2. Option B:

      B, C and D only

    3. Option C:

      A, C and D only

    4. Option D:

      A, B and D only

  56. Question 56Chemistry· Practical Organic Chemistry

    Given below are two statements :

    Statement I: A mixture of C12H22O11\mathrm{C}_{12} \mathrm{H}_{22} \mathrm{O}_{11} (sugar) and NaCl can be separated by dissolving sugar in alcohol, due to differential solubility

    Statement II : Rose essence from rose petals is separated by steam distillation due to its high volatility and insolubility in H2O\mathrm{H}_{2} \mathrm{O}.

    In the light of the above statements, choose the correct answer from the options given below :

    1. Option A:

      Both Statement I and Statement II are true

    2. Option B:

      Both Statement I and Statement II are false

    3. Option C:

      Statement I is true Statement II is false

    4. Option D:

      Statement I is false Statement II is true

  57. Question 57Chemistry· Aldehydes and Ketones

    Shown below is the structure of methyl acetate with three different α,β\alpha, \beta and γ\gamma carbon-oxygen bonds.

    figure

    The correct order of bond length of these bonds is :

    1. Option A:

      α>β>γ\alpha>\beta>\gamma

    2. Option B:

      α<β<γ\alpha<\beta<\gamma

    3. Option C:

      α=β=γ\alpha=\beta=\gamma

    4. Option D:

      α<β=γ\alpha<\beta=\gamma

  58. Question 58Chemistry· Aldehydes and Ketones

    An optically active alkyl bromide C4H9Br\mathrm{C}_{4} \mathrm{H}_{9} \mathrm{Br}, reacts with ethanolic KOH to form major compound [A] which reacts with bromine to give compound [B]. Compound [B] reacts with ethanolic KOH and sodamide to give compound [C]. One molecule of water adds to compound [C] on warming with mercuric sulphate and dilute sulphuric acid at 333 K to form compound [D]. The functional group in compound D will be confirmed by:

    1. Option A:

      Haloform test

    2. Option B:

      Lucas test

    3. Option C:

      Silver mirror test

    4. Option D:

      Benedict test

  59. Question 59Chemistry· Practical Inorganic chemistry (Qualitative Analysis)

    Treatment of a gas ' X ' with a freshly prepared ferrous sulphate solution gives a compound ' Y ' as a brown ring. The compounds X and Y are.

    1. Option A:

      NO and [Fe(NO)]SO4[\mathrm{Fe}(\mathrm{NO})] \mathrm{SO}_{4}

    2. Option B:

      NO2\mathrm{NO}_{2} and [Fe(NO2)]SO4\left[\mathrm{Fe}\left(\mathrm{NO}_{2}\right)\right] \mathrm{SO}_{4}

    3. Option C:

      N2O\mathrm{N}_{2} \mathrm{O} and [Fe(N2O)]SO4\left[\mathrm{Fe}\left(\mathrm{N}_{2} \mathrm{O}\right)\right] \mathrm{SO}_{4}

    4. Option D:

      N2O4\mathrm{N}_{2} \mathrm{O}_{4} and [Fe(N2O4)]SO4\left[\mathrm{Fe}\left(\mathrm{N}_{2} \mathrm{O}_{4}\right)\right] \mathrm{SO}_{4}

  60. Question 60Chemistry· Coordination Compounds

    An excess of AgNO3\mathrm{AgNO}_{3} is added to 100 mL of a 0.05 M solution of tetraaquadichloridochromium (III) chloride. The number of moles of AgCl precipitated will be ____\_\_\_\_ ×10−3\times 10^{-3}. (Nearest integer)

  61. Question 61Chemistry· Hydrocarbons

    An alkane (Y) requires 8 moles of oxygen for complete combustion and on chlorination with Cl2/hv\mathrm{Cl}_{2} / \mathrm{hv}, (Y) gives only one monochlorinated product (Z). The total number of primary carbon atoms in (Y) is ____\_\_\_\_ .

  62. Question 62Chemistry· Redox Reactions

    500 mL of 0.2MMnO4−0.2 \mathrm{M} \mathrm{MnO}_{4}^{-}solution in basic medium when mixed with 500 mL of 1.5 M KI solution, oxidises iodide ions to liberate molecular iodine. This liberated iodine is then titrated with a standard x M thiosulphate solution in presence of starch till the end point. If 300 mL of thiosulphate was consumed, then the value of x is ____\_\_\_\_ .

  63. Question 63Chemistry· Chemical Equilibrium

    In a closed flask at 600 K , one mole of X2Y4( g)\mathrm{X}_{2} \mathrm{Y}_{4}(\mathrm{~g}) attains equilibrium as given below: X2Y4( g)⇌2XY2( g)\mathrm{X}_{2} \mathrm{Y}_{4}(\mathrm{~g}) \rightleftharpoons 2 \mathrm{XY}_{2}(\mathrm{~g}) At equilibrium, 75%X2Y4( g)75 \% \mathrm{X}_{2} \mathrm{Y}_{4}(\mathrm{~g}) was dissociated and the total pressure is 1 atm . The magnitude of ΔrG⊖\Delta_{\mathrm{r}} \mathrm{G}^{\ominus} (in kJmol−1\mathrm{kJ} \mathrm{mol}^{-1} ) at this temperature is ____\_\_\_\_ . (Nearest Integer) (Given: R=8.3 J mol−1 K−1;ln⁡10=2.3\mathrm{R}=8.3 \mathrm{~J} \mathrm{~mol}^{-1} \mathrm{~K}^{-1} ; \ln 10=2.3, log⁡2=0.3,log⁡3=0.48,log⁡5=0.69,log⁡7=0.84)\log 2=0.3, \log 3=0.48, \log 5=0.69, \log 7=0.84)

  64. Question 64Chemistry· Chemical Kinetics

    Decomposition of a hydrocarbon follows the equation k=(5.5×1011 s−1)e−28000 K T\mathrm{k}=\left(5.5 \times 10^{11} \mathrm{~s}^{-1}\right) \mathrm{e}^{\frac{-28000 \mathrm{~K}}{\mathrm{~T}}}. The activation energy of reaction is ____\_\_\_\_ kJmol−1\mathrm{kJ} \mathrm{mol}^{-1}. (Nearest Integer) Given : R=8.3JK−1 mol−1\mathrm{R}=8.3 \mathrm{JK}^{-1} \mathrm{~mol}^{-1}

Stuck on one of these?

Practise questions like them — free, with a tutor that explains every step.